C13H13N3O5 — CID 171880277
5-(4-azido-1,2-dihydroxybutyl)-1-benzofuran-2-carboxylic acid (PubChem CID 171880277) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is 5-(4-azido-1,2-dihydroxybutyl)-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-(4-azido-1,2-dihydroxybutyl)-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 171880277 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 5-(4-azido-1,2-dihydroxybutyl)-1-benzofuran-2-carboxylic acid |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1ccc2oc(C(=O)O)cc2c1 |
| InChI | InChI=1S/C13H13N3O5/c14-16-15-4-3-9(17)12(18)7-1-2-10-8(5-7)6-11(21-10)13(19)20/h1-2,5-6,9,12,17-18H,3-4H2,(H,19,20) |
| InChIKey | ZJJJJEPUSDAQTQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 139.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|