C14H13BrO6 — CID 171893018
6-(4-bromo-1,2-dihydroxybutyl)-4-oxochromene-2-carboxylic acid (PubChem CID 171893018) has the molecular formula C14H13BrO6 and a molecular weight of 357.16 g/mol. Its IUPAC name is 6-(4-bromo-1,2-dihydroxybutyl)-4-oxochromene-2-carboxylic acid.
| Compound Name | 6-(4-bromo-1,2-dihydroxybutyl)-4-oxochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 171893018 |
| Molecular Formula | C14H13BrO6 |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 6-(4-bromo-1,2-dihydroxybutyl)-4-oxochromene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)c2cc(C(O)C(O)CCBr)ccc2o1 |
| InChI | InChI=1S/C14H13BrO6/c15-4-3-9(16)13(18)7-1-2-11-8(5-7)10(17)6-12(21-11)14(19)20/h1-2,5-6,9,13,16,18H,3-4H2,(H,19,20) |
| InChIKey | CXLVCJBSWLACSX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|