C14H15NO6 — CID 170830870
5-(3-acetamido-1,2-dihydroxypropyl)-1-benzofuran-2-carboxylic acid (PubChem CID 170830870) has the molecular formula C14H15NO6 and a molecular weight of 293.28 g/mol. Its IUPAC name is 5-(3-acetamido-1,2-dihydroxypropyl)-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-(3-acetamido-1,2-dihydroxypropyl)-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 170830870 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 5-(3-acetamido-1,2-dihydroxypropyl)-1-benzofuran-2-carboxylic acid |
| SMILES | CC(=O)NCC(O)C(O)c1ccc2oc(C(=O)O)cc2c1 |
| InChI | InChI=1S/C14H15NO6/c1-7(16)15-6-10(17)13(18)8-2-3-11-9(4-8)5-12(21-11)14(19)20/h2-5,10,13,17-18H,6H2,1H3,(H,15,16)(H,19,20) |
| InChIKey | AWGZTXUDFSQOSJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |