C11H16FN3O3 — CID 170830022
N-[3-(3-fluoro-4-hydrazinylphenyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170830022) has the molecular formula C11H16FN3O3 and a molecular weight of 257.26 g/mol. Its IUPAC name is N-[3-(3-fluoro-4-hydrazinylphenyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(3-fluoro-4-hydrazinylphenyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170830022 |
| Molecular Formula | C11H16FN3O3 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[3-(3-fluoro-4-hydrazinylphenyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1ccc(NN)c(F)c1 |
| InChI | InChI=1S/C11H16FN3O3/c1-6(16)14-5-10(17)11(18)7-2-3-9(15-13)8(12)4-7/h2-4,10-11,15,17-18H,5,13H2,1H3,(H,14,16) |
| InChIKey | UZKDRRDVDBGTDC-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|