C9H13FN2O2S — CID 170819840
1-(3-fluoro-4-hydrazinylphenyl)-3-sulfanylpropane-1,2-diol (PubChem CID 170819840) has the molecular formula C9H13FN2O2S and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-(3-fluoro-4-hydrazinylphenyl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(3-fluoro-4-hydrazinylphenyl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170819840 |
| Molecular Formula | C9H13FN2O2S |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 1-(3-fluoro-4-hydrazinylphenyl)-3-sulfanylpropane-1,2-diol |
| SMILES | NNc1ccc(C(O)C(O)CS)cc1F |
| InChI | InChI=1S/C9H13FN2O2S/c10-6-3-5(1-2-7(6)12-11)9(14)8(13)4-15/h1-3,8-9,12-15H,4,11H2 |
| InChIKey | SFAZGKSOVDAEPL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|