C9H13NO3S — CID 170819644
1-(4-amino-3-hydroxyphenyl)-3-sulfanylpropane-1,2-diol (PubChem CID 170819644) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is 1-(4-amino-3-hydroxyphenyl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(4-amino-3-hydroxyphenyl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170819644 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 1-(4-amino-3-hydroxyphenyl)-3-sulfanylpropane-1,2-diol |
| SMILES | Nc1ccc(C(O)C(O)CS)cc1O |
| InChI | InChI=1S/C9H13NO3S/c10-6-2-1-5(3-7(6)11)9(13)8(12)4-14/h1-3,8-9,11-14H,4,10H2 |
| InChIKey | GPNQEIMQXOHPCP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|