C10H12F3NO3S — CID 170820806
1-[4-amino-3-(trifluoromethoxy)phenyl]-3-sulfanylpropane-1,2-diol (PubChem CID 170820806) has the molecular formula C10H12F3NO3S and a molecular weight of 283.27 g/mol. Its IUPAC name is 1-[4-amino-3-(trifluoromethoxy)phenyl]-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-[4-amino-3-(trifluoromethoxy)phenyl]-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170820806 |
| Molecular Formula | C10H12F3NO3S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 1-[4-amino-3-(trifluoromethoxy)phenyl]-3-sulfanylpropane-1,2-diol |
| SMILES | Nc1ccc(C(O)C(O)CS)cc1OC(F)(F)F |
| InChI | InChI=1S/C10H12F3NO3S/c11-10(12,13)17-8-3-5(1-2-6(8)14)9(16)7(15)4-18/h1-3,7,9,15-16,18H,4,14H2 |
| InChIKey | FIIOCDHPRHXXGD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|