C10H5F10NO — CID 58297453
4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethoxy)aniline (PubChem CID 58297453) has the molecular formula C10H5F10NO and a molecular weight of 345.14 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethoxy)aniline.
| Compound Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 58297453 |
| Molecular Formula | C10H5F10NO |
| Molecular Weight | 345.14 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(trifluoromethoxy)aniline |
| SMILES | Nc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1OC(F)(F)F |
| InChI | InChI=1S/C10H5F10NO/c11-7(8(12,13)14,9(15,16)17)4-1-2-5(21)6(3-4)22-10(18,19)20/h1-3H,21H2 |
| InChIKey | HWKOSANXMFQMMT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.14 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|