C15H14F6N4 — CID 138563376
4-[1-(3,4-diaminophenyl)-1,1,2,3,3,3-hexafluoropropan-2-yl]benzene-1,2-diamine (PubChem CID 138563376) has the molecular formula C15H14F6N4 and a molecular weight of 364.29 g/mol. Its IUPAC name is 4-[1-(3,4-diaminophenyl)-1,1,2,3,3,3-hexafluoropropan-2-yl]benzene-1,2-diamine.
| Compound Name | 4-[1-(3,4-diaminophenyl)-1,1,2,3,3,3-hexafluoropropan-2-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 138563376 |
| Molecular Formula | C15H14F6N4 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 4-[1-(3,4-diaminophenyl)-1,1,2,3,3,3-hexafluoropropan-2-yl]benzene-1,2-diamine |
| SMILES | Nc1ccc(C(F)(F)C(F)(c2ccc(N)c(N)c2)C(F)(F)F)cc1N |
| InChI | InChI=1S/C15H14F6N4/c16-13(15(19,20)21,7-1-3-9(22)11(24)5-7)14(17,18)8-2-4-10(23)12(25)6-8/h1-6H,22-25H2 |
| InChIKey | ZBHBGCPRQVZOML-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|