C14H16F7NS — CID 139994405
4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1-propan-2-ylsulfanylethyl)aniline (PubChem CID 139994405) has the molecular formula C14H16F7NS and a molecular weight of 363.34 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1-propan-2-ylsulfanylethyl)aniline.
| Compound Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1-propan-2-ylsulfanylethyl)aniline |
|---|---|
| PubChem CID | 139994405 |
| Molecular Formula | C14H16F7NS |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1-propan-2-ylsulfanylethyl)aniline |
| SMILES | CC(C)SC(C)c1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C14H16F7NS/c1-7(2)23-8(3)10-6-9(4-5-11(10)22)12(15,13(16,17)18)14(19,20)21/h4-8H,22H2,1-3H3 |
| InChIKey | PBLVPHJHMLVMCD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|