C10H9F6NO — CID 124639302
(2S)-2-(4-amino-3-methylphenyl)-1,1,2,3,3,3-hexafluoropropan-1-ol (PubChem CID 124639302) has the molecular formula C10H9F6NO and a molecular weight of 273.18 g/mol. Its IUPAC name is (2S)-2-(4-amino-3-methylphenyl)-1,1,2,3,3,3-hexafluoropropan-1-ol.
| Compound Name | (2S)-2-(4-amino-3-methylphenyl)-1,1,2,3,3,3-hexafluoropropan-1-ol |
|---|---|
| PubChem CID | 124639302 |
| Molecular Formula | C10H9F6NO |
| Molecular Weight | 273.18 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (2S)-2-(4-amino-3-methylphenyl)-1,1,2,3,3,3-hexafluoropropan-1-ol |
| SMILES | Cc1cc([C@](F)(C(O)(F)F)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C10H9F6NO/c1-5-4-6(2-3-7(5)17)8(11,9(12,13)14)10(15,16)18/h2-4,18H,17H2,1H3/t8-/m1/s1 |
| InChIKey | GDNUWUHLMHDORF-MRVPVSSYSA-N |
| XLogP | 2.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.18 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|