C15H12F6N2O2 — CID 22621488
2-amino-4-[1-(3-amino-4-hydroxyphenyl)-1,1,2,3,3,3-hexafluoropropan-2-yl]phenol (PubChem CID 22621488) has the molecular formula C15H12F6N2O2 and a molecular weight of 366.26 g/mol. Its IUPAC name is 2-amino-4-[1-(3-amino-4-hydroxyphenyl)-1,1,2,3,3,3-hexafluoropropan-2-yl]phenol.
| Compound Name | 2-amino-4-[1-(3-amino-4-hydroxyphenyl)-1,1,2,3,3,3-hexafluoropropan-2-yl]phenol |
|---|---|
| PubChem CID | 22621488 |
| Molecular Formula | C15H12F6N2O2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2-amino-4-[1-(3-amino-4-hydroxyphenyl)-1,1,2,3,3,3-hexafluoropropan-2-yl]phenol |
| SMILES | Nc1cc(C(F)(F)C(F)(c2ccc(O)c(N)c2)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C15H12F6N2O2/c16-13(15(19,20)21,7-1-3-11(24)9(22)5-7)14(17,18)8-2-4-12(25)10(23)6-8/h1-6,24-25H,22-23H2 |
| InChIKey | DHDFGUSJYSYXGN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|