C21H16F6N2O2 — CID 87410989
2-amino-4-[1-[2-(4-aminophenoxy)phenyl]-1,1,2,3,3,3-hexafluoropropan-2-yl]phenol (PubChem CID 87410989) has the molecular formula C21H16F6N2O2 and a molecular weight of 442.36 g/mol. Its IUPAC name is 2-amino-4-[1-[2-(4-aminophenoxy)phenyl]-1,1,2,3,3,3-hexafluoropropan-2-yl]phenol.
| Compound Name | 2-amino-4-[1-[2-(4-aminophenoxy)phenyl]-1,1,2,3,3,3-hexafluoropropan-2-yl]phenol |
|---|---|
| PubChem CID | 87410989 |
| Molecular Formula | C21H16F6N2O2 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-amino-4-[1-[2-(4-aminophenoxy)phenyl]-1,1,2,3,3,3-hexafluoropropan-2-yl]phenol |
| SMILES | Nc1ccc(Oc2ccccc2C(F)(F)C(F)(c2ccc(O)c(N)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H16F6N2O2/c22-19(21(25,26)27,12-5-10-17(30)16(29)11-12)20(23,24)15-3-1-2-4-18(15)31-14-8-6-13(28)7-9-14/h1-11,30H,28-29H2 |
| InChIKey | QFIOLMVDVGTJRK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|