C27H20F6N2O2 — CID 22672932
4-[2-[1-[2-(4-aminophenoxy)phenyl]-1,2,2,3,3,3-hexafluoropropyl]phenoxy]aniline (PubChem CID 22672932) has the molecular formula C27H20F6N2O2 and a molecular weight of 518.46 g/mol. Its IUPAC name is 4-[2-[1-[2-(4-aminophenoxy)phenyl]-1,2,2,3,3,3-hexafluoropropyl]phenoxy]aniline.
| Compound Name | 4-[2-[1-[2-(4-aminophenoxy)phenyl]-1,2,2,3,3,3-hexafluoropropyl]phenoxy]aniline |
|---|---|
| PubChem CID | 22672932 |
| Molecular Formula | C27H20F6N2O2 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 4-[2-[1-[2-(4-aminophenoxy)phenyl]-1,2,2,3,3,3-hexafluoropropyl]phenoxy]aniline |
| SMILES | Nc1ccc(Oc2ccccc2C(F)(c2ccccc2Oc2ccc(N)cc2)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H20F6N2O2/c28-25(26(29,30)27(31,32)33,21-5-1-3-7-23(21)36-19-13-9-17(34)10-14-19)22-6-2-4-8-24(22)37-20-15-11-18(35)12-16-20/h1-16H,34-35H2 |
| InChIKey | RBPSHHNQSNDDFL-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|