C35H18F24N2O2 — CID 19910090
4-[4-[2-[4-[4-amino-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline (PubChem CID 19910090) has the molecular formula C35H18F24N2O2 and a molecular weight of 954.49 g/mol. Its IUPAC name is 4-[4-[2-[4-[4-amino-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline.
| Compound Name | 4-[4-[2-[4-[4-amino-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline |
|---|---|
| PubChem CID | 19910090 |
| Molecular Formula | C35H18F24N2O2 |
| Molecular Weight | 954.49 g/mol |
| Exact Mass | 954.10 |
| IUPAC Name | 4-[4-[2-[4-[4-amino-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline |
| SMILES | Nc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(N)cc4C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)(C(F)(F)F)C(F)(F)F)cc2)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C35H18F24N2O2/c36-26(37,28(40,41)30(44,45)34(54,55)56)21-13-17(60)5-11-23(21)62-19-7-1-15(2-8-19)25(32(48,49)50,33(51,52)53)16-3-9-20(10-4-16)63-24-12-6-18(61)14-22(24)27(38,39)29(42,43)31(46,47)35(57,58)59/h1-14H,60-61H2 |
| InChIKey | LZNCQDVYFHLKKB-UHFFFAOYSA-N |
| XLogP | 13.70 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.49 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|