C27H24F6N6O2 — CID 141166403
4-[2-amino-4-[2-[3-amino-4-(2,4-diaminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]benzene-1,3-diamine (PubChem CID 141166403) has the molecular formula C27H24F6N6O2 and a molecular weight of 578.52 g/mol. Its IUPAC name is 4-[2-amino-4-[2-[3-amino-4-(2,4-diaminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]benzene-1,3-diamine.
| Compound Name | 4-[2-amino-4-[2-[3-amino-4-(2,4-diaminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 141166403 |
| Molecular Formula | C27H24F6N6O2 |
| Molecular Weight | 578.52 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | 4-[2-amino-4-[2-[3-amino-4-(2,4-diaminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]benzene-1,3-diamine |
| SMILES | Nc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(N)cc4N)c(N)c3)(C(F)(F)F)C(F)(F)F)cc2N)c(N)c1 |
| InChI | InChI=1S/C27H24F6N6O2/c28-26(29,30)25(27(31,32)33,13-1-5-21(17(36)9-13)40-23-7-3-15(34)11-19(23)38)14-2-6-22(18(37)10-14)41-24-8-4-16(35)12-20(24)39/h1-12H,34-39H2 |
| InChIKey | VGFXHRCWEYFQLQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 174.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.52 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|