C31H16F6N6O2 — CID 134578709
4-[2-amino-4-[2-[3-amino-4-(3,4-dicyanophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 134578709) has the molecular formula C31H16F6N6O2 and a molecular weight of 618.50 g/mol. Its IUPAC name is 4-[2-amino-4-[2-[3-amino-4-(3,4-dicyanophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[2-amino-4-[2-[3-amino-4-(3,4-dicyanophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 134578709 |
| Molecular Formula | C31H16F6N6O2 |
| Molecular Weight | 618.50 g/mol |
| Exact Mass | 618.12 |
| IUPAC Name | 4-[2-amino-4-[2-[3-amino-4-(3,4-dicyanophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(C#N)c(C#N)c4)c(N)c3)(C(F)(F)F)C(F)(F)F)cc2N)cc1C#N |
| InChI | InChI=1S/C31H16F6N6O2/c32-30(33,34)29(31(35,36)37,21-3-7-27(25(42)11-21)44-23-5-1-17(13-38)19(9-23)15-40)22-4-8-28(26(43)12-22)45-24-6-2-18(14-39)20(10-24)16-41/h1-12H,42-43H2 |
| InChIKey | QOUGAFGLVXPZHM-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 165.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.50 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|