C21H16N4O3 — CID 174727909
benzene-1,2-diamine;4-(3,4-dicyanophenoxy)benzoic acid (PubChem CID 174727909) has the molecular formula C21H16N4O3 and a molecular weight of 372.38 g/mol. Its IUPAC name is benzene-1,2-diamine;4-(3,4-dicyanophenoxy)benzoic acid.
| Compound Name | benzene-1,2-diamine;4-(3,4-dicyanophenoxy)benzoic acid |
|---|---|
| PubChem CID | 174727909 |
| Molecular Formula | C21H16N4O3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | benzene-1,2-diamine;4-(3,4-dicyanophenoxy)benzoic acid |
| SMILES | N#Cc1ccc(Oc2ccc(C(=O)O)cc2)cc1C#N.Nc1ccccc1N |
| InChI | InChI=1S/C15H8N2O3.C6H8N2/c16-8-11-3-6-14(7-12(11)9-17)20-13-4-1-10(2-5-13)15(18)19;7-5-3-1-2-4-6(5)8/h1-7H,(H,18,19);1-4H,7-8H2 |
| InChIKey | NQNIIYRARQGTBL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|