C30H12N6O3 — CID 71363047
4-[3,5-bis(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 71363047) has the molecular formula C30H12N6O3 and a molecular weight of 504.47 g/mol. Its IUPAC name is 4-[3,5-bis(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[3,5-bis(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 71363047 |
| Molecular Formula | C30H12N6O3 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 4-[3,5-bis(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Oc2cc(Oc3ccc(C#N)c(C#N)c3)cc(Oc3ccc(C#N)c(C#N)c3)c2)cc1C#N |
| InChI | InChI=1S/C30H12N6O3/c31-13-19-1-4-25(7-22(19)16-34)37-28-10-29(38-26-5-2-20(14-32)23(8-26)17-35)12-30(11-28)39-27-6-3-21(15-33)24(9-27)18-36/h1-12H |
| InChIKey | PUGYXKIQPRPYCF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 170.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |