C32H24N4O2 — CID 139067374
4-(2,6-dimethylphenoxy)benzene-1,2-dicarbonitrile (PubChem CID 139067374) has the molecular formula C32H24N4O2 and a molecular weight of 496.57 g/mol. Its IUPAC name is 4-(2,6-dimethylphenoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(2,6-dimethylphenoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139067374 |
| Molecular Formula | C32H24N4O2 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 4-(2,6-dimethylphenoxy)benzene-1,2-dicarbonitrile |
| SMILES | Cc1cccc(C)c1Oc1ccc(C#N)c(C#N)c1.Cc1cccc(C)c1Oc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/2C16H12N2O/c2*1-11-4-3-5-12(2)16(11)19-15-7-6-13(9-17)14(8-15)10-18/h2*3-8H,1-2H3 |
| InChIKey | AXUPDWPRXXWVRR-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |