C44H24N6O3 — CID 102106236
4-[4-[1,1-bis[4-(3,4-dicyanophenoxy)phenyl]ethyl]phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 102106236) has the molecular formula C44H24N6O3 and a molecular weight of 684.71 g/mol. Its IUPAC name is 4-[4-[1,1-bis[4-(3,4-dicyanophenoxy)phenyl]ethyl]phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[4-[1,1-bis[4-(3,4-dicyanophenoxy)phenyl]ethyl]phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 102106236 |
| Molecular Formula | C44H24N6O3 |
| Molecular Weight | 684.71 g/mol |
| Exact Mass | 684.19 |
| IUPAC Name | 4-[4-[1,1-bis[4-(3,4-dicyanophenoxy)phenyl]ethyl]phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | CC(c1ccc(Oc2ccc(C#N)c(C#N)c2)cc1)(c1ccc(Oc2ccc(C#N)c(C#N)c2)cc1)c1ccc(Oc2ccc(C#N)c(C#N)c2)cc1 |
| InChI | InChI=1S/C44H24N6O3/c1-44(35-5-14-38(15-6-35)51-41-11-2-29(23-45)32(20-41)26-48,36-7-16-39(17-8-36)52-42-12-3-30(24-46)33(21-42)27-49)37-9-18-40(19-10-37)53-43-13-4-31(25-47)34(22-43)28-50/h2-22H,1H3 |
| InChIKey | GTGYPUMQJRGJAF-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 170.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.71 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|