C31H22N6O2 — CID 166451827
4-[2-amino-4-[2-[3-amino-4-(3,4-dicyanophenoxy)phenyl]propan-2-yl]phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 166451827) has the molecular formula C31H22N6O2 and a molecular weight of 510.56 g/mol. Its IUPAC name is 4-[2-amino-4-[2-[3-amino-4-(3,4-dicyanophenoxy)phenyl]propan-2-yl]phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[2-amino-4-[2-[3-amino-4-(3,4-dicyanophenoxy)phenyl]propan-2-yl]phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 166451827 |
| Molecular Formula | C31H22N6O2 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 4-[2-amino-4-[2-[3-amino-4-(3,4-dicyanophenoxy)phenyl]propan-2-yl]phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | CC(C)(c1ccc(Oc2ccc(C#N)c(C#N)c2)c(N)c1)c1ccc(Oc2ccc(C#N)c(C#N)c2)c(N)c1 |
| InChI | InChI=1S/C31H22N6O2/c1-31(2,23-5-9-29(27(36)13-23)38-25-7-3-19(15-32)21(11-25)17-34)24-6-10-30(28(37)14-24)39-26-8-4-20(16-33)22(12-26)18-35/h3-14H,36-37H2,1-2H3 |
| InChIKey | WAJSJSNWOYTYPP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 165.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|