C35H42N2O4S — CID 145044874
5-[2-[3-amino-4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]-2-[4-(4-tert-butylphenyl)sulfonylphenoxy]aniline (PubChem CID 145044874) has the molecular formula C35H42N2O4S and a molecular weight of 586.80 g/mol. Its IUPAC name is 5-[2-[3-amino-4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]-2-[4-(4-tert-butylphenyl)sulfonylphenoxy]aniline.
| Compound Name | 5-[2-[3-amino-4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]-2-[4-(4-tert-butylphenyl)sulfonylphenoxy]aniline |
|---|---|
| PubChem CID | 145044874 |
| Molecular Formula | C35H42N2O4S |
| Molecular Weight | 586.80 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | 5-[2-[3-amino-4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]-2-[4-(4-tert-butylphenyl)sulfonylphenoxy]aniline |
| SMILES | CC(C)(C)Oc1ccc(C(C)(C)c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C(C)(C)C)cc4)cc3)c(N)c2)cc1N |
| InChI | InChI=1S/C35H42N2O4S/c1-33(2,3)23-9-15-27(16-10-23)42(38,39)28-17-13-26(14-18-28)40-31-19-11-24(21-29(31)36)35(7,8)25-12-20-32(30(37)22-25)41-34(4,5)6/h9-22H,36-37H2,1-8H3 |
| InChIKey | DTSGIPHOTFHPRK-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.80 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|