C31H29Cl2O4S+ — CID 123423696
CID 123423696 (PubChem CID 123423696) has the molecular formula C31H29Cl2O4S+ and a molecular weight of 568.54 g/mol.
| Compound Name | CID 123423696 |
|---|---|
| PubChem CID | 123423696 |
| Molecular Formula | C31H29Cl2O4S+ |
| Molecular Weight | 568.54 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | — |
| SMILES | [CH2+]c1ccc(S(=O)(=O)c2ccc(Oc3ccc(C(C)(C)c4ccc(OC)c(CCl)c4)cc3CCl)cc2)cc1 |
| InChI | InChI=1S/C31H29Cl2O4S/c1-21-5-11-27(12-6-21)38(34,35)28-13-9-26(10-14-28)37-30-16-8-25(18-23(30)20-33)31(2,3)24-7-15-29(36-4)22(17-24)19-32/h5-18H,1,19-20H2,2-4H3/q+1 |
| InChIKey | WCMBVUWEHVXHPK-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.54 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|