C31H32O7S2 — CID 118441082
[5-[2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]-3-methylphenyl]propan-2-yl]-2-methylphenyl]methanesulfonic acid (PubChem CID 118441082) has the molecular formula C31H32O7S2 and a molecular weight of 580.72 g/mol. Its IUPAC name is [5-[2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]-3-methylphenyl]propan-2-yl]-2-methylphenyl]methanesulfonic acid.
| Compound Name | [5-[2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]-3-methylphenyl]propan-2-yl]-2-methylphenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 118441082 |
| Molecular Formula | C31H32O7S2 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | [5-[2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]-3-methylphenyl]propan-2-yl]-2-methylphenyl]methanesulfonic acid |
| SMILES | COc1ccc(S(=O)(=O)c2ccc(Oc3ccc(C(C)(C)c4ccc(C)c(CS(=O)(=O)O)c4)cc3C)cc2)cc1 |
| InChI | InChI=1S/C31H32O7S2/c1-21-6-7-25(19-23(21)20-39(32,33)34)31(3,4)24-8-17-30(22(2)18-24)38-27-11-15-29(16-12-27)40(35,36)28-13-9-26(37-5)10-14-28/h6-19H,20H2,1-5H3,(H,32,33,34) |
| InChIKey | FXEOZZQLXYPIMV-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|