C29H28O10S3 — CID 118444014
5-[2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]-3-sulfophenyl]propan-2-yl]-2-methylbenzenesulfonic acid (PubChem CID 118444014) has the molecular formula C29H28O10S3 and a molecular weight of 632.73 g/mol. Its IUPAC name is 5-[2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]-3-sulfophenyl]propan-2-yl]-2-methylbenzenesulfonic acid.
| Compound Name | 5-[2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]-3-sulfophenyl]propan-2-yl]-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 118444014 |
| Molecular Formula | C29H28O10S3 |
| Molecular Weight | 632.73 g/mol |
| Exact Mass | 632.08 |
| IUPAC Name | 5-[2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]-3-sulfophenyl]propan-2-yl]-2-methylbenzenesulfonic acid |
| SMILES | COc1ccc(S(=O)(=O)c2ccc(Oc3ccc(C(C)(C)c4ccc(C)c(S(=O)(=O)O)c4)cc3S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C29H28O10S3/c1-19-5-6-20(17-27(19)41(32,33)34)29(2,3)21-7-16-26(28(18-21)42(35,36)37)39-23-10-14-25(15-11-23)40(30,31)24-12-8-22(38-4)9-13-24/h5-18H,1-4H3,(H,32,33,34)(H,35,36,37) |
| InChIKey | LYKWJNKDPBEDMR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.73 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|