C30H32O4S — CID 161249508
methane;1-[2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]phenyl]propan-2-yl]-4-methylbenzene (PubChem CID 161249508) has the molecular formula C30H32O4S and a molecular weight of 488.65 g/mol. Its IUPAC name is methane;1-[2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]phenyl]propan-2-yl]-4-methylbenzene.
| Compound Name | methane;1-[2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]phenyl]propan-2-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 161249508 |
| Molecular Formula | C30H32O4S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | methane;1-[2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]phenyl]propan-2-yl]-4-methylbenzene |
| SMILES | C.COc1ccc(S(=O)(=O)c2ccc(Oc3ccc(C(C)(C)c4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H28O4S.CH4/c1-21-5-7-22(8-6-21)29(2,3)23-9-11-25(12-10-23)33-26-15-19-28(20-16-26)34(30,31)27-17-13-24(32-4)14-18-27;/h5-20H,1-4H3;1H4 |
| InChIKey | VBBUAIFHZLBUIY-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |