C39H32O7S3 — CID 144623140
(4-methoxyphenyl)-methylidene-[4-[4-[4-[4-(4-methylphenyl)sulfonylphenyl]phenyl]sulfonylphenoxy]phenyl]-oxo-λ6-sulfane (PubChem CID 144623140) has the molecular formula C39H32O7S3 and a molecular weight of 708.88 g/mol. Its IUPAC name is (4-methoxyphenyl)-methylidene-[4-[4-[4-[4-(4-methylphenyl)sulfonylphenyl]phenyl]sulfonylphenoxy]phenyl]-oxo-λ6-sulfane.
| Compound Name | (4-methoxyphenyl)-methylidene-[4-[4-[4-[4-(4-methylphenyl)sulfonylphenyl]phenyl]sulfonylphenoxy]phenyl]-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 144623140 |
| Molecular Formula | C39H32O7S3 |
| Molecular Weight | 708.88 g/mol |
| Exact Mass | 708.13 |
| IUPAC Name | (4-methoxyphenyl)-methylidene-[4-[4-[4-[4-(4-methylphenyl)sulfonylphenyl]phenyl]sulfonylphenoxy]phenyl]-oxo-λ6-sulfane |
| SMILES | C=S(=O)(c1ccc(OC)cc1)c1ccc(Oc2ccc(S(=O)(=O)c3ccc(-c4ccc(S(=O)(=O)c5ccc(C)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H32O7S3/c1-28-4-16-36(17-5-28)48(41,42)37-18-6-29(7-19-37)30-8-20-38(21-9-30)49(43,44)39-26-14-33(15-27-39)46-32-12-24-35(25-13-32)47(3,40)34-22-10-31(45-2)11-23-34/h4-27H,3H2,1-2H3 |
| InChIKey | LGGLSKNADRNBSH-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.88 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|