C14H5Cl3N2O — CID 142771220
4-(2,4,5-trichlorophenoxy)benzene-1,2-dicarbonitrile (PubChem CID 142771220) has the molecular formula C14H5Cl3N2O and a molecular weight of 323.57 g/mol. Its IUPAC name is 4-(2,4,5-trichlorophenoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(2,4,5-trichlorophenoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 142771220 |
| Molecular Formula | C14H5Cl3N2O |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 321.95 |
| IUPAC Name | 4-(2,4,5-trichlorophenoxy)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Oc2cc(Cl)c(Cl)cc2Cl)cc1C#N |
| InChI | InChI=1S/C14H5Cl3N2O/c15-11-4-13(17)14(5-12(11)16)20-10-2-1-8(6-18)9(3-10)7-19/h1-5H |
| InChIKey | CCGHSIXYBLUFEF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|