C13H6Cl3NO — CID 21429570
2-chloro-4-(2,4-dichlorophenoxy)benzonitrile (PubChem CID 21429570) has the molecular formula C13H6Cl3NO and a molecular weight of 298.56 g/mol. Its IUPAC name is 2-chloro-4-(2,4-dichlorophenoxy)benzonitrile.
| Compound Name | 2-chloro-4-(2,4-dichlorophenoxy)benzonitrile |
|---|---|
| PubChem CID | 21429570 |
| Molecular Formula | C13H6Cl3NO |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 296.95 |
| IUPAC Name | 2-chloro-4-(2,4-dichlorophenoxy)benzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C13H6Cl3NO/c14-9-2-4-13(12(16)5-9)18-10-3-1-8(7-17)11(15)6-10/h1-6H |
| InChIKey | PYNMENONJKHJQL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |