2-cyano-5-(2,4-dichlorophenoxy)benzoic acid

C14H7Cl2NO3 — CID 57003483

IUPAC2-cyano-5-(2,4-dichlorophenoxy)benzoic acid
SMILESN#Cc1ccc(Oc2ccc(Cl)cc2Cl)cc1C(=O)O
InChIInChI=1S/C14H7Cl2NO3/c15-9-2-4-13(12(16)5-9)20-10-3-1-8(7-17)11(6-10)14(18)19/h1-6H,(H,18,19)
InChIKeyLCOAYGDPZAIPKF-UHFFFAOYSA-N
MW308.12 g/mol
LogP4.36
Rot. Bonds3

About 2-cyano-5-(2,4-dichlorophenoxy)benzoic acid

2-cyano-5-(2,4-dichlorophenoxy)benzoic acid (PubChem CID 57003483) has the molecular formula C14H7Cl2NO3 and a molecular weight of 308.12 g/mol. Its IUPAC name is 2-cyano-5-(2,4-dichlorophenoxy)benzoic acid.

Molecular Properties

Compound Name2-cyano-5-(2,4-dichlorophenoxy)benzoic acid
PubChem CID57003483
Molecular FormulaC14H7Cl2NO3
Molecular Weight308.12 g/mol
Exact Mass306.98
IUPAC Name2-cyano-5-(2,4-dichlorophenoxy)benzoic acid
SMILESN#Cc1ccc(Oc2ccc(Cl)cc2Cl)cc1C(=O)O
InChIInChI=1S/C14H7Cl2NO3/c15-9-2-4-13(12(16)5-9)20-10-3-1-8(7-17)11(6-10)14(18)19/h1-6H,(H,18,19)
InChIKeyLCOAYGDPZAIPKF-UHFFFAOYSA-N
XLogP4.36
TPSA70.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.12
LogP ≤ 54.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-cyano-5-(2,4-dichlorophenoxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyano-5-(2,4-dichlorophenoxy)benzoic acid?
The IUPAC name of 2-cyano-5-(2,4-dichlorophenoxy)benzoic acid (CID 57003483) is 2-cyano-5-(2,4-dichlorophenoxy)benzoic acid.
What is the SMILES notation for 2-cyano-5-(2,4-dichlorophenoxy)benzoic acid?
The canonical SMILES for 2-cyano-5-(2,4-dichlorophenoxy)benzoic acid is N#Cc1ccc(Oc2ccc(Cl)cc2Cl)cc1C(=O)O.
What is the InChIKey of 2-cyano-5-(2,4-dichlorophenoxy)benzoic acid?
The InChIKey is LCOAYGDPZAIPKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7Cl2NO3/c15-9-2-4-13(12(16)5-9)20-10-3-1-8(7-17)11(6-10)14(18)19/h1-6H,(H,18,19).
What are the key properties of 2-cyano-5-(2,4-dichlorophenoxy)benzoic acid?
2-cyano-5-(2,4-dichlorophenoxy)benzoic acid has a molecular weight of 308.12 g/mol, XLogP of 4.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-5-(2,4-dichlorophenoxy)benzoic acid is sourced from PubChem (CID 57003483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).