C17H13Cl2N3O3 — CID 54298244
methyl 2-cyano-5-(2,4-dichlorophenoxy)-N-(methylcarbamoyl)benzenecarboximidate (PubChem CID 54298244) has the molecular formula C17H13Cl2N3O3 and a molecular weight of 378.22 g/mol. Its IUPAC name is methyl 2-cyano-5-(2,4-dichlorophenoxy)-N-(methylcarbamoyl)benzenecarboximidate.
| Compound Name | methyl 2-cyano-5-(2,4-dichlorophenoxy)-N-(methylcarbamoyl)benzenecarboximidate |
|---|---|
| PubChem CID | 54298244 |
| Molecular Formula | C17H13Cl2N3O3 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | methyl 2-cyano-5-(2,4-dichlorophenoxy)-N-(methylcarbamoyl)benzenecarboximidate |
| SMILES | CNC(=O)N=C(OC)c1cc(Oc2ccc(Cl)cc2Cl)ccc1C#N |
| InChI | InChI=1S/C17H13Cl2N3O3/c1-21-17(23)22-16(24-2)13-8-12(5-3-10(13)9-20)25-15-6-4-11(18)7-14(15)19/h3-8H,1-2H3,(H,21,23) |
| InChIKey | SCHLOZNQFHYIDJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|