C21H12Br2Cl2N2O6 — CID 67406853
3,5-dibromo-4-hydroxybenzonitrile;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate (PubChem CID 67406853) has the molecular formula C21H12Br2Cl2N2O6 and a molecular weight of 619.05 g/mol. Its IUPAC name is 3,5-dibromo-4-hydroxybenzonitrile;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate.
| Compound Name | 3,5-dibromo-4-hydroxybenzonitrile;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate |
|---|---|
| PubChem CID | 67406853 |
| Molecular Formula | C21H12Br2Cl2N2O6 |
| Molecular Weight | 619.05 g/mol |
| Exact Mass | 615.84 |
| IUPAC Name | 3,5-dibromo-4-hydroxybenzonitrile;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate |
| SMILES | COC(=O)c1cc(Oc2ccc(Cl)cc2Cl)ccc1[N+](=O)[O-].N#Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C14H9Cl2NO5.C7H3Br2NO/c1-21-14(18)10-7-9(3-4-12(10)17(19)20)22-13-5-2-8(15)6-11(13)16;8-5-1-4(3-10)2-6(9)7(5)11/h2-7H,1H3;1-2,11H |
| InChIKey | KUGXKVXBFPXLGF-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 122.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.05 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|