C21H23Cl2NO5 — CID 21486095
octyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate (PubChem CID 21486095) has the molecular formula C21H23Cl2NO5 and a molecular weight of 440.32 g/mol. Its IUPAC name is octyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate.
| Compound Name | octyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate |
|---|---|
| PubChem CID | 21486095 |
| Molecular Formula | C21H23Cl2NO5 |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | octyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate |
| SMILES | CCCCCCCCOC(=O)c1cc(Oc2ccc(Cl)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23Cl2NO5/c1-2-3-4-5-6-7-12-28-21(25)17-14-16(9-10-19(17)24(26)27)29-20-11-8-15(22)13-18(20)23/h8-11,13-14H,2-7,12H2,1H3 |
| InChIKey | BKLICPGZXDNACE-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|