C22H17Cl2NO7 — CID 57105797
ethyl 2-[4-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]phenoxy]acetate (PubChem CID 57105797) has the molecular formula C22H17Cl2NO7 and a molecular weight of 478.28 g/mol. Its IUPAC name is ethyl 2-[4-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]phenoxy]acetate |
|---|---|
| PubChem CID | 57105797 |
| Molecular Formula | C22H17Cl2NO7 |
| Molecular Weight | 478.28 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | ethyl 2-[4-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Oc2cc(Oc3ccc(Cl)cc3Cl)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H17Cl2NO7/c1-2-29-22(26)13-30-15-4-6-16(7-5-15)31-21-12-17(8-9-19(21)25(27)28)32-20-10-3-14(23)11-18(20)24/h3-12H,2,13H2,1H3 |
| InChIKey | PBDJAFCZLVTEAW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.28 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|