C15H11Cl2NO5 — CID 71387086
2-[[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]methyl]oxirane (PubChem CID 71387086) has the molecular formula C15H11Cl2NO5 and a molecular weight of 356.16 g/mol. Its IUPAC name is 2-[[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]methyl]oxirane.
| Compound Name | 2-[[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 71387086 |
| Molecular Formula | C15H11Cl2NO5 |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 2-[[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]methyl]oxirane |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(Cl)cc2Cl)cc1OCC1CO1 |
| InChI | InChI=1S/C15H11Cl2NO5/c16-9-1-4-14(12(17)5-9)23-10-2-3-13(18(19)20)15(6-10)22-8-11-7-21-11/h1-6,11H,7-8H2 |
| InChIKey | PZDTYCCHMJADDQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 74.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|