C18H18Cl2N2O6 — CID 70560532
2-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]-N-(2-methoxyethyl)propanamide (PubChem CID 70560532) has the molecular formula C18H18Cl2N2O6 and a molecular weight of 429.26 g/mol. Its IUPAC name is 2-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 70560532 |
| Molecular Formula | C18H18Cl2N2O6 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 2-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)Oc1cc(Oc2ccc(Cl)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18Cl2N2O6/c1-11(18(23)21-7-8-26-2)27-17-10-13(4-5-15(17)22(24)25)28-16-6-3-12(19)9-14(16)20/h3-6,9-11H,7-8H2,1-2H3,(H,21,23) |
| InChIKey | DNCCGYYCLVCDCA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|