C15H10Cl2N2O5S — CID 88666214
2-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]-3-sulfanylidenepropanamide (PubChem CID 88666214) has the molecular formula C15H10Cl2N2O5S and a molecular weight of 401.23 g/mol. Its IUPAC name is 2-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]-3-sulfanylidenepropanamide.
| Compound Name | 2-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 88666214 |
| Molecular Formula | C15H10Cl2N2O5S |
| Molecular Weight | 401.23 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 2-[5-(2,4-dichlorophenoxy)-2-nitrophenoxy]-3-sulfanylidenepropanamide |
| SMILES | NC(=O)C(C=S)Oc1cc(Oc2ccc(Cl)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10Cl2N2O5S/c16-8-1-4-12(10(17)5-8)23-9-2-3-11(19(21)22)13(6-9)24-14(7-25)15(18)20/h1-7,14H,(H2,18,20) |
| InChIKey | XWUHQYSVVSKCAB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|