C14H7Cl4NO4 — CID 71395855
2-(2,2-dichloroethenoxy)-4-(2,4-dichlorophenoxy)-1-nitrobenzene (PubChem CID 71395855) has the molecular formula C14H7Cl4NO4 and a molecular weight of 395.03 g/mol. Its IUPAC name is 2-(2,2-dichloroethenoxy)-4-(2,4-dichlorophenoxy)-1-nitrobenzene.
| Compound Name | 2-(2,2-dichloroethenoxy)-4-(2,4-dichlorophenoxy)-1-nitrobenzene |
|---|---|
| PubChem CID | 71395855 |
| Molecular Formula | C14H7Cl4NO4 |
| Molecular Weight | 395.03 g/mol |
| Exact Mass | 392.91 |
| IUPAC Name | 2-(2,2-dichloroethenoxy)-4-(2,4-dichlorophenoxy)-1-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(Cl)cc2Cl)cc1OC=C(Cl)Cl |
| InChI | InChI=1S/C14H7Cl4NO4/c15-8-1-4-12(10(16)5-8)23-9-2-3-11(19(20)21)13(6-9)22-7-14(17)18/h1-7H |
| InChIKey | OEJHNINJGZXOGC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.03 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|