C18H8Cl5NO4 — CID 12569011
1-chloro-2,3-bis(2,4-dichlorophenoxy)-4-nitrobenzene (PubChem CID 12569011) has the molecular formula C18H8Cl5NO4 and a molecular weight of 479.53 g/mol. Its IUPAC name is 1-chloro-2,3-bis(2,4-dichlorophenoxy)-4-nitrobenzene.
| Compound Name | 1-chloro-2,3-bis(2,4-dichlorophenoxy)-4-nitrobenzene |
|---|---|
| PubChem CID | 12569011 |
| Molecular Formula | C18H8Cl5NO4 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 476.89 |
| IUPAC Name | 1-chloro-2,3-bis(2,4-dichlorophenoxy)-4-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(Oc2ccc(Cl)cc2Cl)c1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H8Cl5NO4/c19-9-1-5-15(12(22)7-9)27-17-11(21)3-4-14(24(25)26)18(17)28-16-6-2-10(20)8-13(16)23/h1-8H |
| InChIKey | PFQFDBAESVNOJZ-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|