C15H14Cl2FNO3Si — CID 10738140
[2-(2,4-dichlorophenoxy)-6-fluoro-3-nitrophenyl]-trimethylsilane (PubChem CID 10738140) has the molecular formula C15H14Cl2FNO3Si and a molecular weight of 374.27 g/mol. Its IUPAC name is [2-(2,4-dichlorophenoxy)-6-fluoro-3-nitrophenyl]-trimethylsilane.
| Compound Name | [2-(2,4-dichlorophenoxy)-6-fluoro-3-nitrophenyl]-trimethylsilane |
|---|---|
| PubChem CID | 10738140 |
| Molecular Formula | C15H14Cl2FNO3Si |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | [2-(2,4-dichlorophenoxy)-6-fluoro-3-nitrophenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1c(F)ccc([N+](=O)[O-])c1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl2FNO3Si/c1-23(2,3)15-11(18)5-6-12(19(20)21)14(15)22-13-7-4-9(16)8-10(13)17/h4-8H,1-3H3 |
| InChIKey | LRFNNFLQQVPGBG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|