C11H6Cl2N2O4 — CID 11771054
3-(2,4-dichlorophenoxy)-4-nitro-1-oxidopyridin-1-ium (PubChem CID 11771054) has the molecular formula C11H6Cl2N2O4 and a molecular weight of 301.09 g/mol. Its IUPAC name is 3-(2,4-dichlorophenoxy)-4-nitro-1-oxidopyridin-1-ium.
| Compound Name | 3-(2,4-dichlorophenoxy)-4-nitro-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 11771054 |
| Molecular Formula | C11H6Cl2N2O4 |
| Molecular Weight | 301.09 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | 3-(2,4-dichlorophenoxy)-4-nitro-1-oxidopyridin-1-ium |
| SMILES | O=[N+]([O-])c1cc[n+]([O-])cc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H6Cl2N2O4/c12-7-1-2-10(8(13)5-7)19-11-6-14(16)4-3-9(11)15(17)18/h1-6H |
| InChIKey | QMMHZFWDFHLURS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 79.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.09 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|