C19H13Cl2NO5S — CID 2743856
4-(benzenesulfonylmethyl)-1-(2,4-dichlorophenoxy)-2-nitrobenzene (PubChem CID 2743856) has the molecular formula C19H13Cl2NO5S and a molecular weight of 438.29 g/mol. Its IUPAC name is 4-(benzenesulfonylmethyl)-1-(2,4-dichlorophenoxy)-2-nitrobenzene.
| Compound Name | 4-(benzenesulfonylmethyl)-1-(2,4-dichlorophenoxy)-2-nitrobenzene |
|---|---|
| PubChem CID | 2743856 |
| Molecular Formula | C19H13Cl2NO5S |
| Molecular Weight | 438.29 g/mol |
| Exact Mass | 436.99 |
| IUPAC Name | 4-(benzenesulfonylmethyl)-1-(2,4-dichlorophenoxy)-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1cc(CS(=O)(=O)c2ccccc2)ccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H13Cl2NO5S/c20-14-7-9-18(16(21)11-14)27-19-8-6-13(10-17(19)22(23)24)12-28(25,26)15-4-2-1-3-5-15/h1-11H,12H2 |
| InChIKey | ZMVUHPADBSBMJS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.29 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|