C13H9Cl2NO4 — CID 28964082
[4-(2,5-dichlorophenoxy)-3-nitrophenyl]methanol (PubChem CID 28964082) has the molecular formula C13H9Cl2NO4 and a molecular weight of 314.12 g/mol. Its IUPAC name is [4-(2,5-dichlorophenoxy)-3-nitrophenyl]methanol.
| Compound Name | [4-(2,5-dichlorophenoxy)-3-nitrophenyl]methanol |
|---|---|
| PubChem CID | 28964082 |
| Molecular Formula | C13H9Cl2NO4 |
| Molecular Weight | 314.12 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | [4-(2,5-dichlorophenoxy)-3-nitrophenyl]methanol |
| SMILES | O=[N+]([O-])c1cc(CO)ccc1Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H9Cl2NO4/c14-9-2-3-10(15)13(6-9)20-12-4-1-8(7-17)5-11(12)16(18)19/h1-6,17H,7H2 |
| InChIKey | BUFNZRDIUASEQL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.12 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|