C13H8Cl2FNO4 — CID 107500272
[4-(4,5-dichloro-2-nitrophenoxy)-3-fluorophenyl]methanol (PubChem CID 107500272) has the molecular formula C13H8Cl2FNO4 and a molecular weight of 332.11 g/mol. Its IUPAC name is [4-(4,5-dichloro-2-nitrophenoxy)-3-fluorophenyl]methanol.
| Compound Name | [4-(4,5-dichloro-2-nitrophenoxy)-3-fluorophenyl]methanol |
|---|---|
| PubChem CID | 107500272 |
| Molecular Formula | C13H8Cl2FNO4 |
| Molecular Weight | 332.11 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | [4-(4,5-dichloro-2-nitrophenoxy)-3-fluorophenyl]methanol |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)cc1Oc1ccc(CO)cc1F |
| InChI | InChI=1S/C13H8Cl2FNO4/c14-8-4-11(17(19)20)13(5-9(8)15)21-12-2-1-7(6-18)3-10(12)16/h1-5,18H,6H2 |
| InChIKey | HBSSXBXIRNMJRC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.11 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|