C15H11Cl2NO5S — CID 134107424
4-(2,4-dichlorophenoxy)-1-nitro-2-prop-2-enylsulfonylbenzene (PubChem CID 134107424) has the molecular formula C15H11Cl2NO5S and a molecular weight of 388.23 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-1-nitro-2-prop-2-enylsulfonylbenzene.
| Compound Name | 4-(2,4-dichlorophenoxy)-1-nitro-2-prop-2-enylsulfonylbenzene |
|---|---|
| PubChem CID | 134107424 |
| Molecular Formula | C15H11Cl2NO5S |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-1-nitro-2-prop-2-enylsulfonylbenzene |
| SMILES | C=CCS(=O)(=O)c1cc(Oc2ccc(Cl)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11Cl2NO5S/c1-2-7-24(21,22)15-9-11(4-5-13(15)18(19)20)23-14-6-3-10(16)8-12(14)17/h2-6,8-9H,1,7H2 |
| InChIKey | DDJAWWLKDVBBNK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|