C16H17Cl2N2O6P — CID 88685260
5-(2,4-dichlorophenoxy)-N-(1-dimethoxyphosphorylethyl)-2-nitroaniline (PubChem CID 88685260) has the molecular formula C16H17Cl2N2O6P and a molecular weight of 435.20 g/mol. Its IUPAC name is 5-(2,4-dichlorophenoxy)-N-(1-dimethoxyphosphorylethyl)-2-nitroaniline.
| Compound Name | 5-(2,4-dichlorophenoxy)-N-(1-dimethoxyphosphorylethyl)-2-nitroaniline |
|---|---|
| PubChem CID | 88685260 |
| Molecular Formula | C16H17Cl2N2O6P |
| Molecular Weight | 435.20 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 5-(2,4-dichlorophenoxy)-N-(1-dimethoxyphosphorylethyl)-2-nitroaniline |
| SMILES | COP(=O)(OC)C(C)Nc1cc(Oc2ccc(Cl)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17Cl2N2O6P/c1-10(27(23,24-2)25-3)19-14-9-12(5-6-15(14)20(21)22)26-16-7-4-11(17)8-13(16)18/h4-10,19H,1-3H3 |
| InChIKey | GGDFIDZPGLZOED-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.20 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|