C20H23Cl2N2O8P — CID 88685396
ethyl 3-[5-(2,4-dichlorophenoxy)-2-nitroanilino]-3-[methoxy(methyl)phosphoryl]oxybutanoate (PubChem CID 88685396) has the molecular formula C20H23Cl2N2O8P and a molecular weight of 521.29 g/mol. Its IUPAC name is ethyl 3-[5-(2,4-dichlorophenoxy)-2-nitroanilino]-3-[methoxy(methyl)phosphoryl]oxybutanoate.
| Compound Name | ethyl 3-[5-(2,4-dichlorophenoxy)-2-nitroanilino]-3-[methoxy(methyl)phosphoryl]oxybutanoate |
|---|---|
| PubChem CID | 88685396 |
| Molecular Formula | C20H23Cl2N2O8P |
| Molecular Weight | 521.29 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | ethyl 3-[5-(2,4-dichlorophenoxy)-2-nitroanilino]-3-[methoxy(methyl)phosphoryl]oxybutanoate |
| SMILES | CCOC(=O)CC(C)(Nc1cc(Oc2ccc(Cl)cc2Cl)ccc1[N+](=O)[O-])OP(C)(=O)OC |
| InChI | InChI=1S/C20H23Cl2N2O8P/c1-5-30-19(25)12-20(2,32-33(4,28)29-3)23-16-11-14(7-8-17(16)24(26)27)31-18-9-6-13(21)10-15(18)22/h6-11,23H,5,12H2,1-4H3 |
| InChIKey | XWTBUYKQZIMDCR-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.29 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|