C16H16Cl3N2O6P — CID 88685616
N-(1-dimethoxyphosphorylethyl)-2-nitro-5-(2,4,6-trichlorophenoxy)aniline (PubChem CID 88685616) has the molecular formula C16H16Cl3N2O6P and a molecular weight of 469.65 g/mol. Its IUPAC name is N-(1-dimethoxyphosphorylethyl)-2-nitro-5-(2,4,6-trichlorophenoxy)aniline.
| Compound Name | N-(1-dimethoxyphosphorylethyl)-2-nitro-5-(2,4,6-trichlorophenoxy)aniline |
|---|---|
| PubChem CID | 88685616 |
| Molecular Formula | C16H16Cl3N2O6P |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 467.98 |
| IUPAC Name | N-(1-dimethoxyphosphorylethyl)-2-nitro-5-(2,4,6-trichlorophenoxy)aniline |
| SMILES | COP(=O)(OC)C(C)Nc1cc(Oc2c(Cl)cc(Cl)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16Cl3N2O6P/c1-9(28(24,25-2)26-3)20-14-8-11(4-5-15(14)21(22)23)27-16-12(18)6-10(17)7-13(16)19/h4-9,20H,1-3H3 |
| InChIKey | KEXPQFYZLKHLPK-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|