C21H22Cl3NO5 — CID 21486106
octan-2-yl 2-nitro-5-(2,4,6-trichlorophenoxy)benzoate (PubChem CID 21486106) has the molecular formula C21H22Cl3NO5 and a molecular weight of 474.77 g/mol. Its IUPAC name is octan-2-yl 2-nitro-5-(2,4,6-trichlorophenoxy)benzoate.
| Compound Name | octan-2-yl 2-nitro-5-(2,4,6-trichlorophenoxy)benzoate |
|---|---|
| PubChem CID | 21486106 |
| Molecular Formula | C21H22Cl3NO5 |
| Molecular Weight | 474.77 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | octan-2-yl 2-nitro-5-(2,4,6-trichlorophenoxy)benzoate |
| SMILES | CCCCCCC(C)OC(=O)c1cc(Oc2c(Cl)cc(Cl)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22Cl3NO5/c1-3-4-5-6-7-13(2)29-21(26)16-12-15(8-9-19(16)25(27)28)30-20-17(23)10-14(22)11-18(20)24/h8-13H,3-7H2,1-2H3 |
| InChIKey | AYKFOQGMPBQZCY-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.77 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|